C22H19N3O5 — CID 90576097
N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 90576097) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90576097 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NCC#CCOc3ccc4c(c3)OCO4)[nH]n2)c1 |
| InChI | InChI=1S/C22H19N3O5/c1-27-16-6-4-5-15(11-16)18-13-19(25-24-18)22(26)23-9-2-3-10-28-17-7-8-20-21(12-17)30-14-29-20/h4-8,11-13H,9-10,14H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | HLQQARLQQMDRIE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|