C17H14N2O3 — CID 18143433
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-cyanobenzamide (PubChem CID 18143433) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-cyanobenzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 18143433 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-cyanobenzamide |
| SMILES | CC(NC(=O)c1cccc(C#N)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N2O3/c1-11(13-5-6-15-16(8-13)22-10-21-15)19-17(20)14-4-2-3-12(7-14)9-18/h2-8,11H,10H2,1H3,(H,19,20) |
| InChIKey | SCYSWQUWJYNWCA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |