C16H12Cl2N2O — CID 35905657
3-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]benzamide (PubChem CID 35905657) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is 3-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 3-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 35905657 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 3-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1cccc(C#N)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O/c1-10(12-5-6-14(17)15(18)8-12)20-16(21)13-4-2-3-11(7-13)9-19/h2-8,10H,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | GTZXMGAECWVDAY-JTQLQIEISA-N |
| XLogP | 4.36 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |