C15H20N2O — CID 24961543
3-cyano-N-(2,4-dimethylpentan-3-yl)benzamide (PubChem CID 24961543) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-cyano-N-(2,4-dimethylpentan-3-yl)benzamide.
| Compound Name | 3-cyano-N-(2,4-dimethylpentan-3-yl)benzamide |
|---|---|
| PubChem CID | 24961543 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3-cyano-N-(2,4-dimethylpentan-3-yl)benzamide |
| SMILES | CC(C)C(NC(=O)c1cccc(C#N)c1)C(C)C |
| InChI | InChI=1S/C15H20N2O/c1-10(2)14(11(3)4)17-15(18)13-7-5-6-12(8-13)9-16/h5-8,10-11,14H,1-4H3,(H,17,18) |
| InChIKey | VLZKDJVJAYBSGT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |