C16H14N2O3 — CID 75499944
N-[1-(3-cyanophenyl)ethyl]-3,4-dihydroxybenzamide (PubChem CID 75499944) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-[1-(3-cyanophenyl)ethyl]-3,4-dihydroxybenzamide.
| Compound Name | N-[1-(3-cyanophenyl)ethyl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 75499944 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[1-(3-cyanophenyl)ethyl]-3,4-dihydroxybenzamide |
| SMILES | CC(NC(=O)c1ccc(O)c(O)c1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H14N2O3/c1-10(12-4-2-3-11(7-12)9-17)18-16(21)13-5-6-14(19)15(20)8-13/h2-8,10,19-20H,1H3,(H,18,21) |
| InChIKey | KXRGFWZJDVGCGR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|