C19H19N3O4 — CID 55790801
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(2-oxoimidazolidin-1-yl)benzamide (PubChem CID 55790801) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(2-oxoimidazolidin-1-yl)benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(2-oxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55790801 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(2-oxoimidazolidin-1-yl)benzamide |
| SMILES | CC(NC(=O)c1cccc(N2CCNC2=O)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19N3O4/c1-12(13-5-6-16-17(10-13)26-11-25-16)21-18(23)14-3-2-4-15(9-14)22-8-7-20-19(22)24/h2-6,9-10,12H,7-8,11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | XKHAJBYQUJXELA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |