C26H23NO4 — CID 90576204
N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3,3-diphenylpropanamide (PubChem CID 90576204) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3,3-diphenylpropanamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 90576204 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)NCC#CCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H23NO4/c28-26(18-23(20-9-3-1-4-10-20)21-11-5-2-6-12-21)27-15-7-8-16-29-22-13-14-24-25(17-22)31-19-30-24/h1-6,9-14,17,23H,15-16,18-19H2,(H,27,28) |
| InChIKey | GPHCMSBWOAUBMD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|