C24H21NO5 — CID 90576179
N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-2-ethoxynaphthalene-1-carboxamide (PubChem CID 90576179) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-2-ethoxynaphthalene-1-carboxamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-2-ethoxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 90576179 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-2-ethoxynaphthalene-1-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1C(=O)NCC#CCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21NO5/c1-2-27-21-11-9-17-7-3-4-8-19(17)23(21)24(26)25-13-5-6-14-28-18-10-12-20-22(15-18)30-16-29-20/h3-4,7-12,15H,2,13-14,16H2,1H3,(H,25,26) |
| InChIKey | QSKVJNYEXYECIQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|