C21H21NO4 — CID 90576203
N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-4-phenylbutanamide (PubChem CID 90576203) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-4-phenylbutanamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 90576203 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)NCC#CCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21NO4/c23-21(10-6-9-17-7-2-1-3-8-17)22-13-4-5-14-24-18-11-12-19-20(15-18)26-16-25-19/h1-3,7-8,11-12,15H,6,9-10,13-14,16H2,(H,22,23) |
| InChIKey | MKBDCHBZYCPSID-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|