About (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate
(3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate (PubChem CID 55642965) has the molecular formula C17H18N2O5S
and a molecular weight of 362.41 g/mol. Its IUPAC name is (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate |
| PubChem CID | 55642965 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)Oc2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C17H18N2O5S/c1-11(2)19-25(22,23)15-8-6-12(7-9-15)17(21)24-14-5-3-4-13(10-14)16(18)20/h3-11,19H,1-2H3,(H2,18,20) |
| InChIKey | QSIXRVOJYQGCAC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate?
The IUPAC name of (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate (CID 55642965) is (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate.
What is the SMILES notation for (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate?
The canonical SMILES for (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate is CC(C)NS(=O)(=O)c1ccc(C(=O)Oc2cccc(C(N)=O)c2)cc1.
What is the InChIKey of (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate?
The InChIKey is QSIXRVOJYQGCAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O5S/c1-11(2)19-25(22,23)15-8-6-12(7-9-15)17(21)24-14-5-3-4-13(10-14)16(18)20/h3-11,19H,1-2H3,(H2,18,20).
What are the key properties of (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate?
(3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate has a molecular weight of 362.41 g/mol, XLogP of 1.69, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamoylphenyl) 4-(propan-2-ylsulfamoyl)benzoate is sourced from PubChem (CID 55642965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).