C18H19NO6S — CID 51335512
methyl 3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylsulfamoyl]benzoate (PubChem CID 51335512) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is methyl 3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylsulfamoyl]benzoate.
| Compound Name | methyl 3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 51335512 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylsulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NC(C)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C18H19NO6S/c1-12(13-6-7-16-17(11-13)25-9-8-24-16)19-26(21,22)15-5-3-4-14(10-15)18(20)23-2/h3-7,10-12,19H,8-9H2,1-2H3 |
| InChIKey | VODIHAIRHVPJJX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |