C20H21NO5 — CID 110374375
methyl 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)butanoylamino]benzoate (PubChem CID 110374375) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)butanoylamino]benzoate.
| Compound Name | methyl 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 110374375 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | methyl 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)butanoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CC(C)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C20H21NO5/c1-13(14-6-7-17-18(12-14)26-9-8-25-17)10-19(22)21-16-5-3-4-15(11-16)20(23)24-2/h3-7,11-13H,8-10H2,1-2H3,(H,21,22) |
| InChIKey | MVSRYDWQWSSHIP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |