C19H21NO4 — CID 110374361
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-methoxyphenyl)butanamide (PubChem CID 110374361) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-methoxyphenyl)butanamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 110374361 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)CC(C)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C19H21NO4/c1-13(14-3-8-17-18(12-14)24-10-9-23-17)11-19(21)20-15-4-6-16(22-2)7-5-15/h3-8,12-13H,9-11H2,1-2H3,(H,20,21) |
| InChIKey | VNIHQBNYVQVXHS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |