C19H16N2O4 — CID 2669322
1,3-benzodioxol-5-yl 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 2669322) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 4-(3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | 1,3-benzodioxol-5-yl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 2669322 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1,3-benzodioxol-5-yl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)Oc3ccc4c(c3)OCO4)cc2)n1 |
| InChI | InChI=1S/C19H16N2O4/c1-12-9-13(2)21(20-12)15-5-3-14(4-6-15)19(22)25-16-7-8-17-18(10-16)24-11-23-17/h3-10H,11H2,1-2H3 |
| InChIKey | GZVCONZHCXAXAS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|