C25H22FN3O4S — CID 2569700
[4-[(4-fluorophenyl)sulfonyl-methylamino]phenyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 2569700) has the molecular formula C25H22FN3O4S and a molecular weight of 479.53 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)sulfonyl-methylamino]phenyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | [4-[(4-fluorophenyl)sulfonyl-methylamino]phenyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 2569700 |
| Molecular Formula | C25H22FN3O4S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | [4-[(4-fluorophenyl)sulfonyl-methylamino]phenyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)Oc3ccc(N(C)S(=O)(=O)c4ccc(F)cc4)cc3)cc2)n1 |
| InChI | InChI=1S/C25H22FN3O4S/c1-17-16-18(2)29(27-17)22-8-4-19(5-9-22)25(30)33-23-12-10-21(11-13-23)28(3)34(31,32)24-14-6-20(26)7-15-24/h4-16H,1-3H3 |
| InChIKey | AFWARJSLVCANQG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|