C11H13N3O3S — CID 22086549
[4-(3,5-dimethylpyrazol-1-yl)phenyl] sulfamate (PubChem CID 22086549) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is [4-(3,5-dimethylpyrazol-1-yl)phenyl] sulfamate.
| Compound Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl] sulfamate |
|---|---|
| PubChem CID | 22086549 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl] sulfamate |
| SMILES | Cc1cc(C)n(-c2ccc(OS(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C11H13N3O3S/c1-8-7-9(2)14(13-8)10-3-5-11(6-4-10)17-18(12,15)16/h3-7H,1-2H3,(H2,12,15,16) |
| InChIKey | DYJYXGFMRKRJPP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |