C15H16N2O2 — CID 50887443
prop-2-enyl 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 50887443) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is prop-2-enyl 4-(3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | prop-2-enyl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 50887443 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | prop-2-enyl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | C=CCOC(=O)c1ccc(-n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C15H16N2O2/c1-4-9-19-15(18)13-5-7-14(8-6-13)17-12(3)10-11(2)16-17/h4-8,10H,1,9H2,2-3H3 |
| InChIKey | NMCOPPKJUNKOKD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|