C20H20N2O3 — CID 16569914
(3-methoxyphenyl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 16569914) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | (3-methoxyphenyl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 16569914 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3-methoxyphenyl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | COc1cccc(COC(=O)c2ccc(-n3nc(C)cc3C)cc2)c1 |
| InChI | InChI=1S/C20H20N2O3/c1-14-11-15(2)22(21-14)18-9-7-17(8-10-18)20(23)25-13-16-5-4-6-19(12-16)24-3/h4-12H,13H2,1-3H3 |
| InChIKey | DOHQSYVZMJDZPI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |