C22H20N4O2 — CID 27831699
(4-pyrazol-1-ylphenyl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 27831699) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 27831699 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)OCc3ccc(-n4cccn4)cc3)cc2)n1 |
| InChI | InChI=1S/C22H20N4O2/c1-16-14-17(2)26(24-16)21-10-6-19(7-11-21)22(27)28-15-18-4-8-20(9-5-18)25-13-3-12-23-25/h3-14H,15H2,1-2H3 |
| InChIKey | OEPPSDDUKRTWNH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |