C22H25N3O4S — CID 27028144
(4-pyrazol-1-ylphenyl)methyl 3-(diethylsulfamoyl)-4-methylbenzoate (PubChem CID 27028144) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 3-(diethylsulfamoyl)-4-methylbenzoate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 3-(diethylsulfamoyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 27028144 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 3-(diethylsulfamoyl)-4-methylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCc2ccc(-n3cccn3)cc2)ccc1C |
| InChI | InChI=1S/C22H25N3O4S/c1-4-24(5-2)30(27,28)21-15-19(10-7-17(21)3)22(26)29-16-18-8-11-20(12-9-18)25-14-6-13-23-25/h6-15H,4-5,16H2,1-3H3 |
| InChIKey | KMWFASNPSPSVKG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |