C21H22N4O5S — CID 16559005
[2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate (PubChem CID 16559005) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate.
| Compound Name | [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate |
|---|---|
| PubChem CID | 16559005 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(-n3cccn3)cc2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H22N4O5S/c1-15-5-8-17(13-19(15)31(28,29)24(2)3)23-20(26)14-30-21(27)16-6-9-18(10-7-16)25-12-4-11-22-25/h4-13H,14H2,1-3H3,(H,23,26) |
| InChIKey | DTAODLJDHCSLIU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |