C23H20N2O5 — CID 4802061
(7-methoxy-2-oxochromen-4-yl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 4802061) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 4802061 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | COc1ccc2c(COC(=O)c3ccc(-n4nc(C)cc4C)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H20N2O5/c1-14-10-15(2)25(24-14)18-6-4-16(5-7-18)23(27)29-13-17-11-22(26)30-21-12-19(28-3)8-9-20(17)21/h4-12H,13H2,1-3H3 |
| InChIKey | UUCQQVLBZYYEQA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|