C21H21NO7S — CID 27614104
(7-methoxy-2-oxochromen-4-yl)methyl 4-[2-(methanesulfonamido)ethyl]benzoate (PubChem CID 27614104) has the molecular formula C21H21NO7S and a molecular weight of 431.47 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 4-[2-(methanesulfonamido)ethyl]benzoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-[2-(methanesulfonamido)ethyl]benzoate |
|---|---|
| PubChem CID | 27614104 |
| Molecular Formula | C21H21NO7S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-[2-(methanesulfonamido)ethyl]benzoate |
| SMILES | COc1ccc2c(COC(=O)c3ccc(CCNS(C)(=O)=O)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H21NO7S/c1-27-17-7-8-18-16(11-20(23)29-19(18)12-17)13-28-21(24)15-5-3-14(4-6-15)9-10-22-30(2,25)26/h3-8,11-12,22H,9-10,13H2,1-2H3 |
| InChIKey | JMOMAZYCAUFXIL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|