C24H24O6 — CID 7265351
(7-methoxy-2-oxochromen-4-yl)methyl 4-oxo-4-(4-propylphenyl)butanoate (PubChem CID 7265351) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 4-oxo-4-(4-propylphenyl)butanoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-oxo-4-(4-propylphenyl)butanoate |
|---|---|
| PubChem CID | 7265351 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-oxo-4-(4-propylphenyl)butanoate |
| SMILES | CCCc1ccc(C(=O)CCC(=O)OCc2cc(=O)oc3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C24H24O6/c1-3-4-16-5-7-17(8-6-16)21(25)11-12-23(26)29-15-18-13-24(27)30-22-14-19(28-2)9-10-20(18)22/h5-10,13-14H,3-4,11-12,15H2,1-2H3 |
| InChIKey | AXNQEWMSAMPOEI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|