C23H19NO5S2 — CID 30293871
(7-methoxy-2-oxochromen-4-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate (PubChem CID 30293871) has the molecular formula C23H19NO5S2 and a molecular weight of 453.54 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 30293871 |
| Molecular Formula | C23H19NO5S2 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate |
| SMILES | COc1ccc2c(COC(=O)c3ccc(SCc4csc(C)n4)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H19NO5S2/c1-14-24-17(12-30-14)13-31-19-6-3-15(4-7-19)23(26)28-11-16-9-22(25)29-21-10-18(27-2)5-8-20(16)21/h3-10,12H,11,13H2,1-2H3 |
| InChIKey | FNZGLHLZHZUBOX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|