(3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate

C17H18O5S — CID 42404752

IUPAC(3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate
SMILESCOc1cccc(COC(=O)c2ccc(CS(C)(=O)=O)cc2)c1
InChIInChI=1S/C17H18O5S/c1-21-16-5-3-4-14(10-16)11-22-17(18)15-8-6-13(7-9-15)12-23(2,19)20/h3-10H,11-12H2,1-2H3
InChIKeyXZLZPANWWUVESN-UHFFFAOYSA-N
MW334.39 g/mol
LogP2.60
Rot. Bonds6

About (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate

(3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate (PubChem CID 42404752) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate.

Molecular Properties

Compound Name(3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate
PubChem CID42404752
Molecular FormulaC17H18O5S
Molecular Weight334.39 g/mol
Exact Mass334.09
IUPAC Name(3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate
SMILESCOc1cccc(COC(=O)c2ccc(CS(C)(=O)=O)cc2)c1
InChIInChI=1S/C17H18O5S/c1-21-16-5-3-4-14(10-16)11-22-17(18)15-8-6-13(7-9-15)12-23(2,19)20/h3-10H,11-12H2,1-2H3
InChIKeyXZLZPANWWUVESN-UHFFFAOYSA-N
XLogP2.60
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.39
LogP ≤ 52.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate?
The IUPAC name of (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate (CID 42404752) is (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate.
What is the SMILES notation for (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate?
The canonical SMILES for (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate is COc1cccc(COC(=O)c2ccc(CS(C)(=O)=O)cc2)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate?
The InChIKey is XZLZPANWWUVESN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O5S/c1-21-16-5-3-4-14(10-16)11-22-17(18)15-8-6-13(7-9-15)12-23(2,19)20/h3-10H,11-12H2,1-2H3.
What are the key properties of (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate?
(3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate has a molecular weight of 334.39 g/mol, XLogP of 2.60, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 4-(methylsulfonylmethyl)benzoate is sourced from PubChem (CID 42404752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).