About (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate
(3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 16569929) has the molecular formula C16H16ClNO5S
and a molecular weight of 369.83 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate |
| PubChem CID | 16569929 |
| Molecular Formula | C16H16ClNO5S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCc2cccc(OC)c2)ccc1Cl |
| InChI | InChI=1S/C16H16ClNO5S/c1-18-24(20,21)15-9-12(6-7-14(15)17)16(19)23-10-11-4-3-5-13(8-11)22-2/h3-9,18H,10H2,1-2H3 |
| InChIKey | OAXXSPRTVYLMLL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate?
The IUPAC name of (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate (CID 16569929) is (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate.
What is the SMILES notation for (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate?
The canonical SMILES for (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate is CNS(=O)(=O)c1cc(C(=O)OCc2cccc(OC)c2)ccc1Cl.
What is the InChIKey of (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate?
The InChIKey is OAXXSPRTVYLMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClNO5S/c1-18-24(20,21)15-9-12(6-7-14(15)17)16(19)23-10-11-4-3-5-13(8-11)22-2/h3-9,18H,10H2,1-2H3.
What are the key properties of (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate?
(3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate has a molecular weight of 369.83 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 4-chloro-3-(methylsulfamoyl)benzoate is sourced from PubChem (CID 16569929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).