C10H9ClN2O4S — CID 9331722
cyanomethyl 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 9331722) has the molecular formula C10H9ClN2O4S and a molecular weight of 288.71 g/mol. Its IUPAC name is cyanomethyl 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | cyanomethyl 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9331722 |
| Molecular Formula | C10H9ClN2O4S |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | cyanomethyl 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCC#N)ccc1Cl |
| InChI | InChI=1S/C10H9ClN2O4S/c1-13-18(15,16)9-6-7(2-3-8(9)11)10(14)17-5-4-12/h2-3,6,13H,5H2,1H3 |
| InChIKey | QASXRWGSMNRUPZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |