C14H16ClN3O5S — CID 7823635
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 7823635) has the molecular formula C14H16ClN3O5S and a molecular weight of 373.82 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7823635 |
| Molecular Formula | C14H16ClN3O5S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCC(=O)N(C)CCC#N)ccc1Cl |
| InChI | InChI=1S/C14H16ClN3O5S/c1-17-24(21,22)12-8-10(4-5-11(12)15)14(20)23-9-13(19)18(2)7-3-6-16/h4-5,8,17H,3,7,9H2,1-2H3 |
| InChIKey | REUIHMQRFQZZFA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |