C14H16N2O4 — CID 7861849
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-methoxybenzoate (PubChem CID 7861849) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-methoxybenzoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 7861849 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N(C)CCC#N)cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-16(9-3-8-15)13(17)10-20-14(18)11-4-6-12(19-2)7-5-11/h4-7H,3,9-10H2,1-2H3 |
| InChIKey | NLTOYMGGJJOERM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |