C14H13N3O3 — CID 8018342
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 8018342) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 8018342 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | CN(CCC#N)C(=O)COC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H13N3O3/c1-17(8-2-7-15)13(18)10-20-14(19)12-5-3-11(9-16)4-6-12/h3-6H,2,8,10H2,1H3 |
| InChIKey | WHBKKWVAYLAJSF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |