C19H14FN3O3 — CID 8018359
[2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 8018359) has the molecular formula C19H14FN3O3 and a molecular weight of 351.34 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 8018359 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1ccc(C#N)cc1)c1ccccc1F |
| InChI | InChI=1S/C19H14FN3O3/c20-16-4-1-2-5-17(16)23(11-3-10-21)18(24)13-26-19(25)15-8-6-14(12-22)7-9-15/h1-2,4-9H,3,11,13H2 |
| InChIKey | NKRGVWHKIAMVIX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |