C22H18FN3O4 — CID 30547730
[2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate (PubChem CID 30547730) has the molecular formula C22H18FN3O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 30547730 |
| Molecular Formula | C22H18FN3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
| SMILES | N#CCCN(C(=O)COC(=O)/C=C/c1ccc(OCC#N)cc1)c1ccccc1F |
| InChI | InChI=1S/C22H18FN3O4/c23-19-4-1-2-5-20(19)26(14-3-12-24)21(27)16-30-22(28)11-8-17-6-9-18(10-7-17)29-15-13-25/h1-2,4-11H,3,14-16H2/b11-8+ |
| InChIKey | FQQBKDPKFGJXLS-DHZHZOJOSA-N |
| XLogP | 3.23 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|