C24H23N3O4 — CID 41218184
[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate (PubChem CID 41218184) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 41218184 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
| SMILES | Cc1cc(C)cc(N(CCC#N)C(=O)COC(=O)/C=C/c2ccc(OCC#N)cc2)c1 |
| InChI | InChI=1S/C24H23N3O4/c1-18-14-19(2)16-21(15-18)27(12-3-10-25)23(28)17-31-24(29)9-6-20-4-7-22(8-5-20)30-13-11-26/h4-9,14-16H,3,12-13,17H2,1-2H3/b9-6+ |
| InChIKey | BVUJXOXWTXZIFM-RMKNXTFCSA-N |
| XLogP | 3.71 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|