C19H22N2O5 — CID 7851593
4-O-[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 7851593) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-O-[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 7851593 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-O-[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(=O)N(CCC#N)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-4-25-18(23)6-7-19(24)26-13-17(22)21(9-5-8-20)16-11-14(2)10-15(3)12-16/h6-7,10-12H,4-5,9,13H2,1-3H3/b7-6+ |
| InChIKey | DXLTWXSEFXFSAG-VOTSOKGWSA-N |
| XLogP | 2.21 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|