C20H20FN3O3 — CID 27997942
[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 27997942) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 27997942 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | Cc1cc(C)cc(N(CCC#N)C(=O)COC(=O)c2ccc(F)cc2N)c1 |
| InChI | InChI=1S/C20H20FN3O3/c1-13-8-14(2)10-16(9-13)24(7-3-6-22)19(25)12-27-20(26)17-5-4-15(21)11-18(17)23/h4-5,8-11H,3,7,12,23H2,1-2H3 |
| InChIKey | QORCLQQEWYSREF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|