C22H23FN2O4 — CID 42966013
[2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate (PubChem CID 42966013) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate.
| Compound Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 42966013 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
| SMILES | Cc1cccc(OCCCC(=O)OCC(=O)N(CCC#N)c2ccccc2F)c1 |
| InChI | InChI=1S/C22H23FN2O4/c1-17-7-4-8-18(15-17)28-14-5-11-22(27)29-16-21(26)25(13-6-12-24)20-10-3-2-9-19(20)23/h2-4,7-10,15H,5-6,11,13-14,16H2,1H3 |
| InChIKey | XVVLNDYTOVNWBL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|