C21H20FN3O5 — CID 42976664
[2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 2-[(E)-(4-methoxyphenyl)methylideneamino]oxyacetate (PubChem CID 42976664) has the molecular formula C21H20FN3O5 and a molecular weight of 413.41 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 2-[(E)-(4-methoxyphenyl)methylideneamino]oxyacetate.
| Compound Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 2-[(E)-(4-methoxyphenyl)methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 42976664 |
| Molecular Formula | C21H20FN3O5 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 2-[(E)-(4-methoxyphenyl)methylideneamino]oxyacetate |
| SMILES | COc1ccc(/C=N/OCC(=O)OCC(=O)N(CCC#N)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H20FN3O5/c1-28-17-9-7-16(8-10-17)13-24-30-15-21(27)29-14-20(26)25(12-4-11-23)19-6-3-2-5-18(19)22/h2-3,5-10,13H,4,12,14-15H2,1H3/b24-13+ |
| InChIKey | PBYHHGWGUMBYBV-ZMOGYAJESA-N |
| XLogP | 2.67 |
| TPSA | 101.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|