C18H17NO5 — CID 8926169
phenacyl 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate (PubChem CID 8926169) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is phenacyl 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate.
| Compound Name | phenacyl 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 8926169 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | phenacyl 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate |
| SMILES | COc1ccc(/C=N\OCC(=O)OCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-22-16-9-7-14(8-10-16)11-19-24-13-18(21)23-12-17(20)15-5-3-2-4-6-15/h2-11H,12-13H2,1H3/b19-11- |
| InChIKey | OVOYVMOYIHOHND-ODLFYWEKSA-N |
| XLogP | 2.47 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|