C17H15Cl2NO4 — CID 8926002
(2,6-dichlorophenyl)methyl 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate (PubChem CID 8926002) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate.
| Compound Name | (2,6-dichlorophenyl)methyl 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 8926002 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate |
| SMILES | COc1ccc(/C=N\OCC(=O)OCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO4/c1-22-13-7-5-12(6-8-13)9-20-24-11-17(21)23-10-14-15(18)3-2-4-16(14)19/h2-9H,10-11H2,1H3/b20-9- |
| InChIKey | RISJDQHBFAGVBI-UKWGHVSLSA-N |
| XLogP | 4.10 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|