C25H27ClN2O6 — CID 42921189
[2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 2-[(E)-(4-methoxyphenyl)methylideneamino]oxyacetate (PubChem CID 42921189) has the molecular formula C25H27ClN2O6 and a molecular weight of 486.95 g/mol. Its IUPAC name is [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 2-[(E)-(4-methoxyphenyl)methylideneamino]oxyacetate.
| Compound Name | [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 2-[(E)-(4-methoxyphenyl)methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 42921189 |
| Molecular Formula | C25H27ClN2O6 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 2-[(E)-(4-methoxyphenyl)methylideneamino]oxyacetate |
| SMILES | COc1ccc(/C=N/OCC(=O)OCC(=O)N(C)C2(c3ccccc3Cl)CCCCC2=O)cc1 |
| InChI | InChI=1S/C25H27ClN2O6/c1-28(25(14-6-5-9-22(25)29)20-7-3-4-8-21(20)26)23(30)16-33-24(31)17-34-27-15-18-10-12-19(32-2)13-11-18/h3-4,7-8,10-13,15H,5-6,9,14,16-17H2,1-2H3/b27-15+ |
| InChIKey | MZTIUGYGVIDWBR-JFLMPSFJSA-N |
| XLogP | 3.74 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|