C18H22ClNO4 — CID 55443861
[2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] propanoate (PubChem CID 55443861) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] propanoate.
| Compound Name | [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 55443861 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)N(C)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C18H22ClNO4/c1-3-17(23)24-12-16(22)20(2)18(11-7-6-10-15(18)21)13-8-4-5-9-14(13)19/h4-5,8-9H,3,6-7,10-12H2,1-2H3 |
| InChIKey | GGWPPXMZQDYDID-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |