C25H29ClN2O6 — CID 42921185
[2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 42921185) has the molecular formula C25H29ClN2O6 and a molecular weight of 488.97 g/mol. Its IUPAC name is [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 42921185 |
| Molecular Formula | C25H29ClN2O6 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | CN(C(=O)COC(=O)CN1C(=O)C2CCCCC2C1=O)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C25H29ClN2O6/c1-27(25(13-7-6-12-20(25)29)18-10-4-5-11-19(18)26)21(30)15-34-22(31)14-28-23(32)16-8-2-3-9-17(16)24(28)33/h4-5,10-11,16-17H,2-3,6-9,12-15H2,1H3 |
| InChIKey | YMZFMZIYCGASAI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|