C22H21ClN2O6 — CID 43034041
[2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 4-nitrobenzoate (PubChem CID 43034041) has the molecular formula C22H21ClN2O6 and a molecular weight of 444.87 g/mol. Its IUPAC name is [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 43034041 |
| Molecular Formula | C22H21ClN2O6 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [2-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]-2-oxoethyl] 4-nitrobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc([N+](=O)[O-])cc1)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C22H21ClN2O6/c1-24(20(27)14-31-21(28)15-9-11-16(12-10-15)25(29)30)22(13-5-4-8-19(22)26)17-6-2-3-7-18(17)23/h2-3,6-7,9-12H,4-5,8,13-14H2,1H3 |
| InChIKey | AWBHNZLXPRSGCS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|