C22H22ClNO4 — CID 55761597
methyl 3-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]benzoate (PubChem CID 55761597) has the molecular formula C22H22ClNO4 and a molecular weight of 399.87 g/mol. Its IUPAC name is methyl 3-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 55761597 |
| Molecular Formula | C22H22ClNO4 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | methyl 3-[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)N(C)C2(c3ccccc3Cl)CCCCC2=O)c1 |
| InChI | InChI=1S/C22H22ClNO4/c1-24(20(26)15-8-7-9-16(14-15)21(27)28-2)22(13-6-5-12-19(22)25)17-10-3-4-11-18(17)23/h3-4,7-11,14H,5-6,12-13H2,1-2H3 |
| InChIKey | PMUFIHJRWMUDSL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |