C19H23ClN2O6 — CID 146192254
[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 2-acetamidoacetate (PubChem CID 146192254) has the molecular formula C19H23ClN2O6 and a molecular weight of 410.85 g/mol. Its IUPAC name is [[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 2-acetamidoacetate.
| Compound Name | [[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 2-acetamidoacetate |
|---|---|
| PubChem CID | 146192254 |
| Molecular Formula | C19H23ClN2O6 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 2-acetamidoacetate |
| SMILES | CC(=O)NCC(=O)OCOC(=O)N(C)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C19H23ClN2O6/c1-13(23)21-11-17(25)27-12-28-18(26)22(2)19(10-6-5-9-16(19)24)14-7-3-4-8-15(14)20/h3-4,7-8H,5-6,9-12H2,1-2H3,(H,21,23) |
| InChIKey | NFMKQBYSCAAWPO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|