C22H29ClN2O6 — CID 146651315
2-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyethyl 4-acetamidobutanoate (PubChem CID 146651315) has the molecular formula C22H29ClN2O6 and a molecular weight of 452.94 g/mol. Its IUPAC name is 2-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyethyl 4-acetamidobutanoate.
| Compound Name | 2-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyethyl 4-acetamidobutanoate |
|---|---|
| PubChem CID | 146651315 |
| Molecular Formula | C22H29ClN2O6 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyethyl 4-acetamidobutanoate |
| SMILES | CC(=O)NCCCC(=O)OCCOC(=O)N(C)[C@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C22H29ClN2O6/c1-16(26)24-13-7-11-20(28)30-14-15-31-21(29)25(2)22(12-6-5-10-19(22)27)17-8-3-4-9-18(17)23/h3-4,8-9H,5-7,10-15H2,1-2H3,(H,24,26)/t22-/m0/s1 |
| InChIKey | OLLTXUFCNRHVMK-QFIPXVFZSA-N |
| XLogP | 3.21 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|