C20H24ClNO6 — CID 158267948
[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 4-oxopentanoate (PubChem CID 158267948) has the molecular formula C20H24ClNO6 and a molecular weight of 409.87 g/mol. Its IUPAC name is [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 4-oxopentanoate.
| Compound Name | [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 4-oxopentanoate |
|---|---|
| PubChem CID | 158267948 |
| Molecular Formula | C20H24ClNO6 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCOC(=O)N(C)[C@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C20H24ClNO6/c1-14(23)10-11-18(25)27-13-28-19(26)22(2)20(12-6-5-9-17(20)24)15-7-3-4-8-16(15)21/h3-4,7-8H,5-6,9-13H2,1-2H3/t20-/m0/s1 |
| InChIKey | JDRBDMRUMMTISF-FQEVSTJZSA-N |
| XLogP | 3.62 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|