C23H33ClN2O5 — CID 153445532
[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl (2S,3R)-2-(dimethylamino)-3-methylpentanoate (PubChem CID 153445532) has the molecular formula C23H33ClN2O5 and a molecular weight of 452.98 g/mol. Its IUPAC name is [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl (2S,3R)-2-(dimethylamino)-3-methylpentanoate.
| Compound Name | [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl (2S,3R)-2-(dimethylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 153445532 |
| Molecular Formula | C23H33ClN2O5 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl (2S,3R)-2-(dimethylamino)-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](C(=O)OCOC(=O)N(C)[C@]1(c2ccccc2Cl)CCCCC1=O)N(C)C |
| InChI | InChI=1S/C23H33ClN2O5/c1-6-16(2)20(25(3)4)21(28)30-15-31-22(29)26(5)23(14-10-9-13-19(23)27)17-11-7-8-12-18(17)24/h7-8,11-12,16,20H,6,9-10,13-15H2,1-5H3/t16-,20+,23+/m1/s1 |
| InChIKey | OEZFEESSXVVRKY-CGYQNGNCSA-N |
| XLogP | 4.22 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|