C15H19ClNO6P — CID 166087043
dihydroxyphosphanyloxymethyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate (PubChem CID 166087043) has the molecular formula C15H19ClNO6P and a molecular weight of 375.75 g/mol. Its IUPAC name is dihydroxyphosphanyloxymethyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate.
| Compound Name | dihydroxyphosphanyloxymethyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 166087043 |
| Molecular Formula | C15H19ClNO6P |
| Molecular Weight | 375.75 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | dihydroxyphosphanyloxymethyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCOP(O)O)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C15H19ClNO6P/c1-17(14(19)22-10-23-24(20)21)15(9-5-4-8-13(15)18)11-6-2-3-7-12(11)16/h2-3,6-7,20-21H,4-5,8-10H2,1H3 |
| InChIKey | ZSAYREUARUXKMX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|